C8H6F3N5O — CID 169462315
5-(3-azidoprop-1-enyl)-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 169462315) has the molecular formula C8H6F3N5O and a molecular weight of 245.16 g/mol. Its IUPAC name is 5-(3-azidoprop-1-enyl)-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 5-(3-azidoprop-1-enyl)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 169462315 |
| Molecular Formula | C8H6F3N5O |
| Molecular Weight | 245.16 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 5-(3-azidoprop-1-enyl)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | [N-]=[N+]=NCC=Cc1c(C(F)(F)F)nc[nH]c1=O |
| InChI | InChI=1S/C8H6F3N5O/c9-8(10,11)6-5(2-1-3-15-16-12)7(17)14-4-13-6/h1-2,4H,3H2,(H,13,14,17) |
| InChIKey | OTCSXYQWQXKQKO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 94.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.16 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|