C8H7F3N2OS — CID 169455771
5-(3-sulfanylprop-1-enyl)-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 169455771) has the molecular formula C8H7F3N2OS and a molecular weight of 236.22 g/mol. Its IUPAC name is 5-(3-sulfanylprop-1-enyl)-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 5-(3-sulfanylprop-1-enyl)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 169455771 |
| Molecular Formula | C8H7F3N2OS |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 5-(3-sulfanylprop-1-enyl)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(C(F)(F)F)c1C=CCS |
| InChI | InChI=1S/C8H7F3N2OS/c9-8(10,11)6-5(2-1-3-15)7(14)13-4-12-6/h1-2,4,15H,3H2,(H,12,13,14) |
| InChIKey | MBRQLKFLZYFPEI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|