C9H7F3N2O2 — CID 170482461
4-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]but-3-enal (PubChem CID 170482461) has the molecular formula C9H7F3N2O2 and a molecular weight of 232.16 g/mol. Its IUPAC name is 4-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]but-3-enal.
| Compound Name | 4-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]but-3-enal |
|---|---|
| PubChem CID | 170482461 |
| Molecular Formula | C9H7F3N2O2 |
| Molecular Weight | 232.16 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 4-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]but-3-enal |
| SMILES | O=CCC=Cc1c(C(F)(F)F)nc[nH]c1=O |
| InChI | InChI=1S/C9H7F3N2O2/c10-9(11,12)7-6(3-1-2-4-15)8(16)14-5-13-7/h1,3-5H,2H2,(H,13,14,16) |
| InChIKey | LLXZZUWHEZXWMT-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.16 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|