C8H5F3N2O2 — CID 169459590
3-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]prop-2-enal (PubChem CID 169459590) has the molecular formula C8H5F3N2O2 and a molecular weight of 218.13 g/mol. Its IUPAC name is 3-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]prop-2-enal.
| Compound Name | 3-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]prop-2-enal |
|---|---|
| PubChem CID | 169459590 |
| Molecular Formula | C8H5F3N2O2 |
| Molecular Weight | 218.13 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 3-[6-oxo-4-(trifluoromethyl)-1H-pyrimidin-5-yl]prop-2-enal |
| SMILES | O=CC=Cc1c(C(F)(F)F)nc[nH]c1=O |
| InChI | InChI=1S/C8H5F3N2O2/c9-8(10,11)6-5(2-1-3-14)7(15)13-4-12-6/h1-4H,(H,12,13,15) |
| InChIKey | IIQQNBSIMSNKSK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.13 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|