C10H12F3N3O — CID 170496354
5-[4-(methylamino)but-1-enyl]-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 170496354) has the molecular formula C10H12F3N3O and a molecular weight of 247.22 g/mol. Its IUPAC name is 5-[4-(methylamino)but-1-enyl]-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 5-[4-(methylamino)but-1-enyl]-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 170496354 |
| Molecular Formula | C10H12F3N3O |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 5-[4-(methylamino)but-1-enyl]-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | CNCCC=Cc1c(C(F)(F)F)nc[nH]c1=O |
| InChI | InChI=1S/C10H12F3N3O/c1-14-5-3-2-4-7-8(10(11,12)13)15-6-16-9(7)17/h2,4,6,14H,3,5H2,1H3,(H,15,16,17) |
| InChIKey | DPTNAUBNGASCGQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|