C13H25NO2Si — CID 10015249
tert-butyl 6-trimethylsilyl-3,4-dihydro-2H-pyridine-1-carboxylate (PubChem CID 10015249) has the molecular formula C13H25NO2Si and a molecular weight of 255.43 g/mol. Its IUPAC name is tert-butyl 6-trimethylsilyl-3,4-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 6-trimethylsilyl-3,4-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 10015249 |
| Molecular Formula | C13H25NO2Si |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | tert-butyl 6-trimethylsilyl-3,4-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC=C1[Si](C)(C)C |
| InChI | InChI=1S/C13H25NO2Si/c1-13(2,3)16-12(15)14-10-8-7-9-11(14)17(4,5)6/h9H,7-8,10H2,1-6H3 |
| InChIKey | KTVZRIIBNIVBDD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|