C13H25NO3Si — CID 69254395
tert-butyl 6-trimethylsilyloxy-3,4-dihydro-2H-pyridine-1-carboxylate (PubChem CID 69254395) has the molecular formula C13H25NO3Si and a molecular weight of 271.43 g/mol. Its IUPAC name is tert-butyl 6-trimethylsilyloxy-3,4-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 6-trimethylsilyloxy-3,4-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 69254395 |
| Molecular Formula | C13H25NO3Si |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | tert-butyl 6-trimethylsilyloxy-3,4-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC=C1O[Si](C)(C)C |
| InChI | InChI=1S/C13H25NO3Si/c1-13(2,3)16-12(15)14-10-8-7-9-11(14)17-18(4,5)6/h9H,7-8,10H2,1-6H3 |
| InChIKey | APNJLYOGUKXDHC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|