C13H16S3 — CID 10015873
6-ethenyl-8-prop-2-ynylsulfanyl-1,4-dithiaspiro[4.5]dec-6-ene (PubChem CID 10015873) has the molecular formula C13H16S3 and a molecular weight of 268.47 g/mol. Its IUPAC name is 6-ethenyl-8-prop-2-ynylsulfanyl-1,4-dithiaspiro[4.5]dec-6-ene.
| Compound Name | 6-ethenyl-8-prop-2-ynylsulfanyl-1,4-dithiaspiro[4.5]dec-6-ene |
|---|---|
| PubChem CID | 10015873 |
| Molecular Formula | C13H16S3 |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 6-ethenyl-8-prop-2-ynylsulfanyl-1,4-dithiaspiro[4.5]dec-6-ene |
| SMILES | C#CCSC1C=C(C=C)C2(CC1)SCCS2 |
| InChI | InChI=1S/C13H16S3/c1-3-7-14-12-5-6-13(11(4-2)10-12)15-8-9-16-13/h1,4,10,12H,2,5-9H2 |
| InChIKey | DTLBKLXSYINRLJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|