C15H20S3 — CID 10334755
9-ethenyl-10-methyl-11-prop-2-ynylsulfanyl-1,5-dithiaspiro[5.5]undec-9-ene (PubChem CID 10334755) has the molecular formula C15H20S3 and a molecular weight of 296.53 g/mol. Its IUPAC name is 9-ethenyl-10-methyl-11-prop-2-ynylsulfanyl-1,5-dithiaspiro[5.5]undec-9-ene.
| Compound Name | 9-ethenyl-10-methyl-11-prop-2-ynylsulfanyl-1,5-dithiaspiro[5.5]undec-9-ene |
|---|---|
| PubChem CID | 10334755 |
| Molecular Formula | C15H20S3 |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 9-ethenyl-10-methyl-11-prop-2-ynylsulfanyl-1,5-dithiaspiro[5.5]undec-9-ene |
| SMILES | C#CCSC1C(C)=C(C=C)CCC12SCCCS2 |
| InChI | InChI=1S/C15H20S3/c1-4-9-16-14-12(3)13(5-2)7-8-15(14)17-10-6-11-18-15/h1,5,14H,2,6-11H2,3H3 |
| InChIKey | YXRKIJDBGMLDTN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|