C12H16S — CID 10035490
1-ethenyl-2-methyl-3-prop-2-ynylsulfanylcyclohexene (PubChem CID 10035490) has the molecular formula C12H16S and a molecular weight of 192.33 g/mol. Its IUPAC name is 1-ethenyl-2-methyl-3-prop-2-ynylsulfanylcyclohexene.
| Compound Name | 1-ethenyl-2-methyl-3-prop-2-ynylsulfanylcyclohexene |
|---|---|
| PubChem CID | 10035490 |
| Molecular Formula | C12H16S |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 1-ethenyl-2-methyl-3-prop-2-ynylsulfanylcyclohexene |
| SMILES | C#CCSC1CCCC(C=C)=C1C |
| InChI | InChI=1S/C12H16S/c1-4-9-13-12-8-6-7-11(5-2)10(12)3/h1,5,12H,2,6-9H2,3H3 |
| InChIKey | DLNLUSQEKZMSCA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|