C13H18S — CID 10442989
1-ethenyl-5,5-dimethyl-3-prop-2-ynylsulfanylcyclohexene (PubChem CID 10442989) has the molecular formula C13H18S and a molecular weight of 206.35 g/mol. Its IUPAC name is 1-ethenyl-5,5-dimethyl-3-prop-2-ynylsulfanylcyclohexene.
| Compound Name | 1-ethenyl-5,5-dimethyl-3-prop-2-ynylsulfanylcyclohexene |
|---|---|
| PubChem CID | 10442989 |
| Molecular Formula | C13H18S |
| Molecular Weight | 206.35 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-ethenyl-5,5-dimethyl-3-prop-2-ynylsulfanylcyclohexene |
| SMILES | C#CCSC1C=C(C=C)CC(C)(C)C1 |
| InChI | InChI=1S/C13H18S/c1-5-7-14-12-8-11(6-2)9-13(3,4)10-12/h1,6,8,12H,2,7,9-10H2,3-4H3 |
| InChIKey | QBHGKNRKMRSFOB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|