C17H24S3 — CID 10041959
9-ethenyl-8,11,11-trimethyl-7-prop-2-ynylsulfanyl-1,5-dithiaspiro[5.5]undec-8-ene (PubChem CID 10041959) has the molecular formula C17H24S3 and a molecular weight of 324.58 g/mol. Its IUPAC name is 9-ethenyl-8,11,11-trimethyl-7-prop-2-ynylsulfanyl-1,5-dithiaspiro[5.5]undec-8-ene.
| Compound Name | 9-ethenyl-8,11,11-trimethyl-7-prop-2-ynylsulfanyl-1,5-dithiaspiro[5.5]undec-8-ene |
|---|---|
| PubChem CID | 10041959 |
| Molecular Formula | C17H24S3 |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 9-ethenyl-8,11,11-trimethyl-7-prop-2-ynylsulfanyl-1,5-dithiaspiro[5.5]undec-8-ene |
| SMILES | C#CCSC1C(C)=C(C=C)CC(C)(C)C12SCCCS2 |
| InChI | InChI=1S/C17H24S3/c1-6-9-18-15-13(3)14(7-2)12-16(4,5)17(15)19-10-8-11-20-17/h1,7,15H,2,8-12H2,3-5H3 |
| InChIKey | ORHUBQBQJOFKOU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|