C23H34S2 — CID 10926867
2-[(1E,3E,5E,7E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-1,3,5,7-tetraenyl]-1,3-dithiane (PubChem CID 10926867) has the molecular formula C23H34S2 and a molecular weight of 374.66 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-1,3,5,7-tetraenyl]-1,3-dithiane.
| Compound Name | 2-[(1E,3E,5E,7E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-1,3,5,7-tetraenyl]-1,3-dithiane |
|---|---|
| PubChem CID | 10926867 |
| Molecular Formula | C23H34S2 |
| Molecular Weight | 374.66 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 2-[(1E,3E,5E,7E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-1,3,5,7-tetraenyl]-1,3-dithiane |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C2SCCCS2)C(C)(C)CCC1 |
| InChI | InChI=1S/C23H34S2/c1-18(12-13-21-20(3)11-7-14-23(21,4)5)9-6-10-19(2)17-22-24-15-8-16-25-22/h6,9-10,12-13,17,22H,7-8,11,14-16H2,1-5H3/b10-6+,13-12+,18-9+,19-17+ |
| InChIKey | CARNOULDFNDEFW-MPLKWBRTSA-N |
| XLogP | 7.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.66 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|