C18H32OSi — CID 10017242
1-[(3R,3aR,7aS)-2-[tert-butyl(dimethyl)silyl]-3-methyl-3,4,5,6,7,7a-hexahydroinden-3a-yl]ethanone (PubChem CID 10017242) has the molecular formula C18H32OSi and a molecular weight of 292.54 g/mol. Its IUPAC name is 1-[(3R,3aR,7aS)-2-[tert-butyl(dimethyl)silyl]-3-methyl-3,4,5,6,7,7a-hexahydroinden-3a-yl]ethanone.
| Compound Name | 1-[(3R,3aR,7aS)-2-[tert-butyl(dimethyl)silyl]-3-methyl-3,4,5,6,7,7a-hexahydroinden-3a-yl]ethanone |
|---|---|
| PubChem CID | 10017242 |
| Molecular Formula | C18H32OSi |
| Molecular Weight | 292.54 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1-[(3R,3aR,7aS)-2-[tert-butyl(dimethyl)silyl]-3-methyl-3,4,5,6,7,7a-hexahydroinden-3a-yl]ethanone |
| SMILES | CC(=O)[C@]12CCCC[C@H]1C=C([Si](C)(C)C(C)(C)C)[C@@H]2C |
| InChI | InChI=1S/C18H32OSi/c1-13-16(20(6,7)17(3,4)5)12-15-10-8-9-11-18(13,15)14(2)19/h12-13,15H,8-11H2,1-7H3/t13-,15-,18+/m0/s1 |
| InChIKey | RUSFXOXZBSYNSA-DHSIGJKJSA-N |
| XLogP | 5.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|