C17H26O4 — CID 154223068
(2,3a,4,5-tetramethyl-7,8,9,10-tetrahydro-6aH-benzo[h][1,3]benzodioxol-4-yl) acetate (PubChem CID 154223068) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is (2,3a,4,5-tetramethyl-7,8,9,10-tetrahydro-6aH-benzo[h][1,3]benzodioxol-4-yl) acetate.
| Compound Name | (2,3a,4,5-tetramethyl-7,8,9,10-tetrahydro-6aH-benzo[h][1,3]benzodioxol-4-yl) acetate |
|---|---|
| PubChem CID | 154223068 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (2,3a,4,5-tetramethyl-7,8,9,10-tetrahydro-6aH-benzo[h][1,3]benzodioxol-4-yl) acetate |
| SMILES | CC(=O)OC1(C)C(C)=CC2CCCCC23OC(C)OC13C |
| InChI | InChI=1S/C17H26O4/c1-11-10-14-8-6-7-9-17(14)16(5,20-13(3)21-17)15(11,4)19-12(2)18/h10,13-14H,6-9H2,1-5H3 |
| InChIKey | KCPONLWJGBLUFG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|