C9H11ClO2Pd — CID 10017252
chloropalladium(1+);5-methanidylidene-4-methoxy-2,4-dimethylcyclopent-2-en-1-one (PubChem CID 10017252) has the molecular formula C9H11ClO2Pd and a molecular weight of 293.06 g/mol. Its IUPAC name is chloropalladium(1+);5-methanidylidene-4-methoxy-2,4-dimethylcyclopent-2-en-1-one.
| Compound Name | chloropalladium(1+);5-methanidylidene-4-methoxy-2,4-dimethylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 10017252 |
| Molecular Formula | C9H11ClO2Pd |
| Molecular Weight | 293.06 g/mol |
| Exact Mass | 291.95 |
| IUPAC Name | chloropalladium(1+);5-methanidylidene-4-methoxy-2,4-dimethylcyclopent-2-en-1-one |
| SMILES | Cl[Pd+].[H]/[C-]=C1/C(=O)C(C)=CC1(C)OC |
| InChI | InChI=1S/C9H11O2.ClH.Pd/c1-6-5-9(3,11-4)7(2)8(6)10;;/h2,5H,1,3-4H3;1H;/q-1;;+2/p-1 |
| InChIKey | SIQOONHJSBEJQK-UHFFFAOYSA-M |
| XLogP | 1.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.06 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|