C18H28O2 — CID 10401246
(5Z)-4-methoxy-2,3,4-trimethyl-5-[(E)-non-2-en-5-ylidene]cyclopent-2-en-1-one (PubChem CID 10401246) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is (5Z)-4-methoxy-2,3,4-trimethyl-5-[(E)-non-2-en-5-ylidene]cyclopent-2-en-1-one.
| Compound Name | (5Z)-4-methoxy-2,3,4-trimethyl-5-[(E)-non-2-en-5-ylidene]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 10401246 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | (5Z)-4-methoxy-2,3,4-trimethyl-5-[(E)-non-2-en-5-ylidene]cyclopent-2-en-1-one |
| SMILES | C/C=C/C/C(CCCC)=C1\C(=O)C(C)=C(C)C1(C)OC |
| InChI | InChI=1S/C18H28O2/c1-7-9-11-15(12-10-8-2)16-17(19)13(3)14(4)18(16,5)20-6/h7,9H,8,10-12H2,1-6H3/b9-7+,16-15- |
| InChIKey | FGVUGJBEFMGMAF-CTPARUFQSA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|