C21H34O2 — CID 10403621
(5Z)-5-dodec-1-en-4-ylidene-4-methoxy-2,3,4-trimethylcyclopent-2-en-1-one (PubChem CID 10403621) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (5Z)-5-dodec-1-en-4-ylidene-4-methoxy-2,3,4-trimethylcyclopent-2-en-1-one.
| Compound Name | (5Z)-5-dodec-1-en-4-ylidene-4-methoxy-2,3,4-trimethylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 10403621 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (5Z)-5-dodec-1-en-4-ylidene-4-methoxy-2,3,4-trimethylcyclopent-2-en-1-one |
| SMILES | C=CC/C(CCCCCCCC)=C1\C(=O)C(C)=C(C)C1(C)OC |
| InChI | InChI=1S/C21H34O2/c1-7-9-10-11-12-13-15-18(14-8-2)19-20(22)16(3)17(4)21(19,5)23-6/h8H,2,7,9-15H2,1,3-6H3/b19-18- |
| InChIKey | KGNHWJAFRCDBSG-HNENSFHCSA-N |
| XLogP | 5.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|