C18H28O3 — CID 10017223
(5Z)-5-[(E)-1-hydroxynon-2-en-5-ylidene]-4-methoxy-2,3,4-trimethylcyclopent-2-en-1-one (PubChem CID 10017223) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (5Z)-5-[(E)-1-hydroxynon-2-en-5-ylidene]-4-methoxy-2,3,4-trimethylcyclopent-2-en-1-one.
| Compound Name | (5Z)-5-[(E)-1-hydroxynon-2-en-5-ylidene]-4-methoxy-2,3,4-trimethylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 10017223 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (5Z)-5-[(E)-1-hydroxynon-2-en-5-ylidene]-4-methoxy-2,3,4-trimethylcyclopent-2-en-1-one |
| SMILES | CCCC/C(C/C=C/CO)=C1/C(=O)C(C)=C(C)C1(C)OC |
| InChI | InChI=1S/C18H28O3/c1-6-7-10-15(11-8-9-12-19)16-17(20)13(2)14(3)18(16,4)21-5/h8-9,19H,6-7,10-12H2,1-5H3/b9-8+,16-15+ |
| InChIKey | ZUFOPTZSSKXTCI-IZCPETMFSA-N |
| XLogP | 3.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|