C17H26O3 — CID 10265575
(5Z)-5-(8-hydroxyoct-1-en-4-ylidene)-4-methoxy-2,3,4-trimethylcyclopent-2-en-1-one (PubChem CID 10265575) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (5Z)-5-(8-hydroxyoct-1-en-4-ylidene)-4-methoxy-2,3,4-trimethylcyclopent-2-en-1-one.
| Compound Name | (5Z)-5-(8-hydroxyoct-1-en-4-ylidene)-4-methoxy-2,3,4-trimethylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 10265575 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (5Z)-5-(8-hydroxyoct-1-en-4-ylidene)-4-methoxy-2,3,4-trimethylcyclopent-2-en-1-one |
| SMILES | C=CC/C(CCCCO)=C1\C(=O)C(C)=C(C)C1(C)OC |
| InChI | InChI=1S/C17H26O3/c1-6-9-14(10-7-8-11-18)15-16(19)12(2)13(3)17(15,4)20-5/h6,18H,1,7-11H2,2-5H3/b15-14- |
| InChIKey | BYKDPPQUDKMQES-PFONDFGASA-N |
| XLogP | 3.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|