C13H19HgO3 — CID 10052909
[(Z)-[3-(4-hydroxybutyl)-2-methoxy-2,4-dimethyl-5-oxocyclopent-3-en-1-ylidene]methyl]mercury (PubChem CID 10052909) has the molecular formula C13H19HgO3 and a molecular weight of 423.88 g/mol. Its IUPAC name is [(Z)-[3-(4-hydroxybutyl)-2-methoxy-2,4-dimethyl-5-oxocyclopent-3-en-1-ylidene]methyl]mercury.
| Compound Name | [(Z)-[3-(4-hydroxybutyl)-2-methoxy-2,4-dimethyl-5-oxocyclopent-3-en-1-ylidene]methyl]mercury |
|---|---|
| PubChem CID | 10052909 |
| Molecular Formula | C13H19HgO3 |
| Molecular Weight | 423.88 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | [(Z)-[3-(4-hydroxybutyl)-2-methoxy-2,4-dimethyl-5-oxocyclopent-3-en-1-ylidene]methyl]mercury |
| SMILES | COC1(C)C(CCCCO)=C(C)C(=O)/C1=C\[Hg] |
| InChI | InChI=1S/C13H19O3.Hg/c1-9-11(7-5-6-8-14)13(3,16-4)10(2)12(9)15;/h2,14H,5-8H2,1,3-4H3; |
| InChIKey | XWZCCECKSSGWBA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.88 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|