C12H17HgO2 — CID 10029226
[(Z)-(3-butyl-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-ylidene)methyl]mercury (PubChem CID 10029226) has the molecular formula C12H17HgO2 and a molecular weight of 393.86 g/mol. Its IUPAC name is [(Z)-(3-butyl-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-ylidene)methyl]mercury.
| Compound Name | [(Z)-(3-butyl-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-ylidene)methyl]mercury |
|---|---|
| PubChem CID | 10029226 |
| Molecular Formula | C12H17HgO2 |
| Molecular Weight | 393.86 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | [(Z)-(3-butyl-2-methoxy-2-methyl-5-oxocyclopent-3-en-1-ylidene)methyl]mercury |
| SMILES | CCCCC1=CC(=O)/C(=C\[Hg])C1(C)OC |
| InChI | InChI=1S/C12H17O2.Hg/c1-5-6-7-10-8-11(13)9(2)12(10,3)14-4;/h2,8H,5-7H2,1,3-4H3; |
| InChIKey | BAECDGHWIIYMBW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.86 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|