C17H27ClO2Pd — CID 10024221
chloropalladium(1+);5-methanidylidene-4-methoxy-2,4-dimethyl-3-octylcyclopent-2-en-1-one (PubChem CID 10024221) has the molecular formula C17H27ClO2Pd and a molecular weight of 405.27 g/mol. Its IUPAC name is chloropalladium(1+);5-methanidylidene-4-methoxy-2,4-dimethyl-3-octylcyclopent-2-en-1-one.
| Compound Name | chloropalladium(1+);5-methanidylidene-4-methoxy-2,4-dimethyl-3-octylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 10024221 |
| Molecular Formula | C17H27ClO2Pd |
| Molecular Weight | 405.27 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | chloropalladium(1+);5-methanidylidene-4-methoxy-2,4-dimethyl-3-octylcyclopent-2-en-1-one |
| SMILES | Cl[Pd+].[H]/[C-]=C1/C(=O)C(C)=C(CCCCCCCC)C1(C)OC |
| InChI | InChI=1S/C17H27O2.ClH.Pd/c1-6-7-8-9-10-11-12-15-13(2)16(18)14(3)17(15,4)19-5;;/h3H,6-12H2,1-2,4-5H3;1H;/q-1;;+2/p-1 |
| InChIKey | LPYWBFUJMRACBD-UHFFFAOYSA-M |
| XLogP | 5.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.27 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|