C15H20F3HgO5 — CID 10052908
[(Z)-[3-(4-hydroxybutyl)-2-methoxy-2,4-dimethyl-5-oxocyclopent-3-en-1-ylidene]methyl]mercury;2,2,2-trifluoroacetic acid (PubChem CID 10052908) has the molecular formula C15H20F3HgO5 and a molecular weight of 537.90 g/mol. Its IUPAC name is [(Z)-[3-(4-hydroxybutyl)-2-methoxy-2,4-dimethyl-5-oxocyclopent-3-en-1-ylidene]methyl]mercury;2,2,2-trifluoroacetic acid.
| Compound Name | [(Z)-[3-(4-hydroxybutyl)-2-methoxy-2,4-dimethyl-5-oxocyclopent-3-en-1-ylidene]methyl]mercury;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 10052908 |
| Molecular Formula | C15H20F3HgO5 |
| Molecular Weight | 537.90 g/mol |
| Exact Mass | 539.10 |
| IUPAC Name | [(Z)-[3-(4-hydroxybutyl)-2-methoxy-2,4-dimethyl-5-oxocyclopent-3-en-1-ylidene]methyl]mercury;2,2,2-trifluoroacetic acid |
| SMILES | COC1(C)C(CCCCO)=C(C)C(=O)/C1=C\[Hg].O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H19O3.C2HF3O2.Hg/c1-9-11(7-5-6-8-14)13(3,16-4)10(2)12(9)15;3-2(4,5)1(6)7;/h2,14H,5-8H2,1,3-4H3;(H,6,7); |
| InChIKey | MGXWHLFDZLUIAN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.90 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|