C14H18F3HgO4 — CID 10481331
[(Z)-(2-methoxy-2,4-dimethyl-5-oxo-3-propylcyclopent-3-en-1-ylidene)methyl]mercury;2,2,2-trifluoroacetic acid (PubChem CID 10481331) has the molecular formula C14H18F3HgO4 and a molecular weight of 507.88 g/mol. Its IUPAC name is [(Z)-(2-methoxy-2,4-dimethyl-5-oxo-3-propylcyclopent-3-en-1-ylidene)methyl]mercury;2,2,2-trifluoroacetic acid.
| Compound Name | [(Z)-(2-methoxy-2,4-dimethyl-5-oxo-3-propylcyclopent-3-en-1-ylidene)methyl]mercury;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 10481331 |
| Molecular Formula | C14H18F3HgO4 |
| Molecular Weight | 507.88 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | [(Z)-(2-methoxy-2,4-dimethyl-5-oxo-3-propylcyclopent-3-en-1-ylidene)methyl]mercury;2,2,2-trifluoroacetic acid |
| SMILES | CCCC1=C(C)C(=O)/C(=C\[Hg])C1(C)OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H17O2.C2HF3O2.Hg/c1-6-7-10-8(2)11(13)9(3)12(10,4)14-5;3-2(4,5)1(6)7;/h3H,6-7H2,1-2,4-5H3;(H,6,7); |
| InChIKey | WSKBYULICSTCJI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.88 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|