C15H19F3HgO5 — CID 16686255
[(Z)-[3-(4-hydroxybutyl)-2-methoxy-2,4-dimethyl-5-oxocyclopent-3-en-1-ylidene]methyl]-(2,2,2-trifluoroacetyl)oxymercury (PubChem CID 16686255) has the molecular formula C15H19F3HgO5 and a molecular weight of 536.90 g/mol. Its IUPAC name is [(Z)-[3-(4-hydroxybutyl)-2-methoxy-2,4-dimethyl-5-oxocyclopent-3-en-1-ylidene]methyl]-(2,2,2-trifluoroacetyl)oxymercury.
| Compound Name | [(Z)-[3-(4-hydroxybutyl)-2-methoxy-2,4-dimethyl-5-oxocyclopent-3-en-1-ylidene]methyl]-(2,2,2-trifluoroacetyl)oxymercury |
|---|---|
| PubChem CID | 16686255 |
| Molecular Formula | C15H19F3HgO5 |
| Molecular Weight | 536.90 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | [(Z)-[3-(4-hydroxybutyl)-2-methoxy-2,4-dimethyl-5-oxocyclopent-3-en-1-ylidene]methyl]-(2,2,2-trifluoroacetyl)oxymercury |
| SMILES | COC1(C)C(CCCCO)=C(C)C(=O)/C1=C\[Hg]OC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H19O3.C2HF3O2.Hg/c1-9-11(7-5-6-8-14)13(3,16-4)10(2)12(9)15;3-2(4,5)1(6)7;/h2,14H,5-8H2,1,3-4H3;(H,6,7);/q;;+1/p-1 |
| InChIKey | GFVOEZHADDEKEA-UHFFFAOYSA-M |
| XLogP | 2.44 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.90 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|