C13H19ClO2Pd — CID 10043388
3-butyl-5-methanidylidene-4-methoxy-2,4-dimethylcyclopent-2-en-1-one;chloropalladium(1+) (PubChem CID 10043388) has the molecular formula C13H19ClO2Pd and a molecular weight of 349.17 g/mol. Its IUPAC name is 3-butyl-5-methanidylidene-4-methoxy-2,4-dimethylcyclopent-2-en-1-one;chloropalladium(1+).
| Compound Name | 3-butyl-5-methanidylidene-4-methoxy-2,4-dimethylcyclopent-2-en-1-one;chloropalladium(1+) |
|---|---|
| PubChem CID | 10043388 |
| Molecular Formula | C13H19ClO2Pd |
| Molecular Weight | 349.17 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 3-butyl-5-methanidylidene-4-methoxy-2,4-dimethylcyclopent-2-en-1-one;chloropalladium(1+) |
| SMILES | Cl[Pd+].[H]/[C-]=C1/C(=O)C(C)=C(CCCC)C1(C)OC |
| InChI | InChI=1S/C13H19O2.ClH.Pd/c1-6-7-8-11-9(2)12(14)10(3)13(11,4)15-5;;/h3H,6-8H2,1-2,4-5H3;1H;/q-1;;+2/p-1 |
| InChIKey | NSAHHOKEFJZBFO-UHFFFAOYSA-M |
| XLogP | 3.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.17 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|