C16H28O3 — CID 143483487
(7S,8E)-7-hydroxy-10-methoxy-4,8,11-trimethyldodeca-8,11-dien-5-one (PubChem CID 143483487) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is (7S,8E)-7-hydroxy-10-methoxy-4,8,11-trimethyldodeca-8,11-dien-5-one.
| Compound Name | (7S,8E)-7-hydroxy-10-methoxy-4,8,11-trimethyldodeca-8,11-dien-5-one |
|---|---|
| PubChem CID | 143483487 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | (7S,8E)-7-hydroxy-10-methoxy-4,8,11-trimethyldodeca-8,11-dien-5-one |
| SMILES | C=C(C)C(/C=C(\C)[C@@H](O)CC(=O)C(C)CCC)OC |
| InChI | InChI=1S/C16H28O3/c1-7-8-12(4)14(17)10-15(18)13(5)9-16(19-6)11(2)3/h9,12,15-16,18H,2,7-8,10H2,1,3-6H3/b13-9+/t12?,15-,16?/m0/s1 |
| InChIKey | HAMJLNKYBAZABZ-ZHKHRBRZSA-N |
| XLogP | 3.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|