C16H24O2 — CID 10444716
(5Z)-5-hept-1-en-4-ylidene-4-methoxy-2,3,4-trimethylcyclopent-2-en-1-one (PubChem CID 10444716) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (5Z)-5-hept-1-en-4-ylidene-4-methoxy-2,3,4-trimethylcyclopent-2-en-1-one.
| Compound Name | (5Z)-5-hept-1-en-4-ylidene-4-methoxy-2,3,4-trimethylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 10444716 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (5Z)-5-hept-1-en-4-ylidene-4-methoxy-2,3,4-trimethylcyclopent-2-en-1-one |
| SMILES | C=CC/C(CCC)=C1\C(=O)C(C)=C(C)C1(C)OC |
| InChI | InChI=1S/C16H24O2/c1-7-9-13(10-8-2)14-15(17)11(3)12(4)16(14,5)18-6/h7H,1,8-10H2,2-6H3/b14-13- |
| InChIKey | KMRHCCLDMATOBQ-YPKPFQOOSA-N |
| XLogP | 3.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|