C18H30O2 — CID 59966360
4-[(2-methylpropan-2-yl)oxy]-2-[(Z)-non-2-enyl]cyclopent-2-en-1-one (PubChem CID 59966360) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 4-[(2-methylpropan-2-yl)oxy]-2-[(Z)-non-2-enyl]cyclopent-2-en-1-one.
| Compound Name | 4-[(2-methylpropan-2-yl)oxy]-2-[(Z)-non-2-enyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 59966360 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxy]-2-[(Z)-non-2-enyl]cyclopent-2-en-1-one |
| SMILES | CCCCCC/C=C\CC1=CC(OC(C)(C)C)CC1=O |
| InChI | InChI=1S/C18H30O2/c1-5-6-7-8-9-10-11-12-15-13-16(14-17(15)19)20-18(2,3)4/h10-11,13,16H,5-9,12,14H2,1-4H3/b11-10- |
| InChIKey | KPUOZPYPRCSRFF-KHPPLWFESA-N |
| XLogP | 4.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|