C18H23N3O — CID 10017542
(3S)-4-benzyl-8-methoxy-3-methyl-1,2,3,5-tetrahydro-1,4-benzodiazepin-9-amine (PubChem CID 10017542) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is (3S)-4-benzyl-8-methoxy-3-methyl-1,2,3,5-tetrahydro-1,4-benzodiazepin-9-amine.
| Compound Name | (3S)-4-benzyl-8-methoxy-3-methyl-1,2,3,5-tetrahydro-1,4-benzodiazepin-9-amine |
|---|---|
| PubChem CID | 10017542 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | (3S)-4-benzyl-8-methoxy-3-methyl-1,2,3,5-tetrahydro-1,4-benzodiazepin-9-amine |
| SMILES | COc1ccc2c(c1N)NC[C@H](C)N(Cc1ccccc1)C2 |
| InChI | InChI=1S/C18H23N3O/c1-13-10-20-18-15(8-9-16(22-2)17(18)19)12-21(13)11-14-6-4-3-5-7-14/h3-9,13,20H,10-12,19H2,1-2H3/t13-/m0/s1 |
| InChIKey | NMXLLTSBMCTQMT-ZDUSSCGKSA-N |
| XLogP | 3.09 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|