C28H31NO5 — CID 11048836
2-[(3R,4R)-2-benzyl-3-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-4-yl]acetaldehyde (PubChem CID 11048836) has the molecular formula C28H31NO5 and a molecular weight of 461.56 g/mol. Its IUPAC name is 2-[(3R,4R)-2-benzyl-3-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-4-yl]acetaldehyde.
| Compound Name | 2-[(3R,4R)-2-benzyl-3-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 11048836 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 2-[(3R,4R)-2-benzyl-3-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-4-yl]acetaldehyde |
| SMILES | COc1ccc([C@H]2[C@H](CC=O)c3cc(OC)c(OC)cc3CN2Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C28H31NO5/c1-31-24-11-10-20(14-25(24)32-2)28-22(12-13-30)23-16-27(34-4)26(33-3)15-21(23)18-29(28)17-19-8-6-5-7-9-19/h5-11,13-16,22,28H,12,17-18H2,1-4H3/t22-,28+/m1/s1 |
| InChIKey | UUMVNZAXOABQLO-DFHRPNOPSA-N |
| XLogP | 5.15 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|