C27H30ClNO2 — CID 86613423
(6aS,12bR)-6-benzyl-10,11-dimethoxy-3-methyl-6a,7,8,12b-tetrahydro-5H-benzo[a]phenanthridine;hydrochloride (PubChem CID 86613423) has the molecular formula C27H30ClNO2 and a molecular weight of 436.00 g/mol. Its IUPAC name is (6aS,12bR)-6-benzyl-10,11-dimethoxy-3-methyl-6a,7,8,12b-tetrahydro-5H-benzo[a]phenanthridine;hydrochloride.
| Compound Name | (6aS,12bR)-6-benzyl-10,11-dimethoxy-3-methyl-6a,7,8,12b-tetrahydro-5H-benzo[a]phenanthridine;hydrochloride |
|---|---|
| PubChem CID | 86613423 |
| Molecular Formula | C27H30ClNO2 |
| Molecular Weight | 436.00 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | (6aS,12bR)-6-benzyl-10,11-dimethoxy-3-methyl-6a,7,8,12b-tetrahydro-5H-benzo[a]phenanthridine;hydrochloride |
| SMILES | COc1cc2c(cc1OC)[C@@H]1c3ccc(C)cc3CN(Cc3ccccc3)[C@H]1CC2.Cl |
| InChI | InChI=1S/C27H29NO2.ClH/c1-18-9-11-22-21(13-18)17-28(16-19-7-5-4-6-8-19)24-12-10-20-14-25(29-2)26(30-3)15-23(20)27(22)24;/h4-9,11,13-15,24,27H,10,12,16-17H2,1-3H3;1H/t24-,27-;/m0./s1 |
| InChIKey | XVFWMDRZXQNXIZ-GAOQVRBLSA-N |
| XLogP | 5.90 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.00 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |