C20H24ClNO2 — CID 86613416
(6aS,12bR)-10,11-dimethoxy-2-methyl-5,6,6a,7,8,12b-hexahydrobenzo[a]phenanthridine;hydrochloride (PubChem CID 86613416) has the molecular formula C20H24ClNO2 and a molecular weight of 345.87 g/mol. Its IUPAC name is (6aS,12bR)-10,11-dimethoxy-2-methyl-5,6,6a,7,8,12b-hexahydrobenzo[a]phenanthridine;hydrochloride.
| Compound Name | (6aS,12bR)-10,11-dimethoxy-2-methyl-5,6,6a,7,8,12b-hexahydrobenzo[a]phenanthridine;hydrochloride |
|---|---|
| PubChem CID | 86613416 |
| Molecular Formula | C20H24ClNO2 |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | (6aS,12bR)-10,11-dimethoxy-2-methyl-5,6,6a,7,8,12b-hexahydrobenzo[a]phenanthridine;hydrochloride |
| SMILES | COc1cc2c(cc1OC)[C@@H]1c3cc(C)ccc3CN[C@H]1CC2.Cl |
| InChI | InChI=1S/C20H23NO2.ClH/c1-12-4-5-14-11-21-17-7-6-13-9-18(22-2)19(23-3)10-16(13)20(17)15(14)8-12;/h4-5,8-10,17,20-21H,6-7,11H2,1-3H3;1H/t17-,20-;/m0./s1 |
| InChIKey | WCFUSMROAKUGSY-ZHXLSBKVSA-N |
| XLogP | 3.98 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |