C18H18BrNO2 — CID 139760126
(6aS,12bR)-4-bromo-10-methoxy-5,6,6a,7,8,12b-hexahydrobenzo[a]phenanthridin-11-ol (PubChem CID 139760126) has the molecular formula C18H18BrNO2 and a molecular weight of 360.25 g/mol. Its IUPAC name is (6aS,12bR)-4-bromo-10-methoxy-5,6,6a,7,8,12b-hexahydrobenzo[a]phenanthridin-11-ol.
| Compound Name | (6aS,12bR)-4-bromo-10-methoxy-5,6,6a,7,8,12b-hexahydrobenzo[a]phenanthridin-11-ol |
|---|---|
| PubChem CID | 139760126 |
| Molecular Formula | C18H18BrNO2 |
| Molecular Weight | 360.25 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | (6aS,12bR)-4-bromo-10-methoxy-5,6,6a,7,8,12b-hexahydrobenzo[a]phenanthridin-11-ol |
| SMILES | COc1cc2c(cc1O)[C@@H]1c3cccc(Br)c3CN[C@H]1CC2 |
| InChI | InChI=1S/C18H18BrNO2/c1-22-17-7-10-5-6-15-18(12(10)8-16(17)21)11-3-2-4-14(19)13(11)9-20-15/h2-4,7-8,15,18,20-21H,5-6,9H2,1H3/t15-,18-/m0/s1 |
| InChIKey | FLLGGWOCRNVOFU-YJBOKZPZSA-N |
| XLogP | 3.71 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.25 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |