C16H33N3O2 — CID 10017644
(2S)-2-[(3-amino-2-hydroxypropyl)amino]-N-tert-butyl-3-cyclohexylpropanamide (PubChem CID 10017644) has the molecular formula C16H33N3O2 and a molecular weight of 299.46 g/mol. Its IUPAC name is (2S)-2-[(3-amino-2-hydroxypropyl)amino]-N-tert-butyl-3-cyclohexylpropanamide.
| Compound Name | (2S)-2-[(3-amino-2-hydroxypropyl)amino]-N-tert-butyl-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 10017644 |
| Molecular Formula | C16H33N3O2 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | (2S)-2-[(3-amino-2-hydroxypropyl)amino]-N-tert-butyl-3-cyclohexylpropanamide |
| SMILES | CC(C)(C)NC(=O)[C@H](CC1CCCCC1)NCC(O)CN |
| InChI | InChI=1S/C16H33N3O2/c1-16(2,3)19-15(21)14(18-11-13(20)10-17)9-12-7-5-4-6-8-12/h12-14,18,20H,4-11,17H2,1-3H3,(H,19,21)/t13?,14-/m0/s1 |
| InChIKey | QXSKZKZAUXHQNP-KZUDCZAMSA-N |
| XLogP | 1.15 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |