C10H6F8O2 — CID 10018238
3,3,4,4-tetrafluoro-1-methoxy-2-(3,3,4,4-tetrafluoro-2-methoxycyclobuten-1-yl)cyclobutene (PubChem CID 10018238) has the molecular formula C10H6F8O2 and a molecular weight of 310.14 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-1-methoxy-2-(3,3,4,4-tetrafluoro-2-methoxycyclobuten-1-yl)cyclobutene.
| Compound Name | 3,3,4,4-tetrafluoro-1-methoxy-2-(3,3,4,4-tetrafluoro-2-methoxycyclobuten-1-yl)cyclobutene |
|---|---|
| PubChem CID | 10018238 |
| Molecular Formula | C10H6F8O2 |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 3,3,4,4-tetrafluoro-1-methoxy-2-(3,3,4,4-tetrafluoro-2-methoxycyclobuten-1-yl)cyclobutene |
| SMILES | COC1=C(C2=C(OC)C(F)(F)C2(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H6F8O2/c1-19-5-3(7(11,12)9(5,15)16)4-6(20-2)10(17,18)8(4,13)14/h1-2H3 |
| InChIKey | FXCVKBNEHFJZGM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|