C12H6F12O2 — CID 10386828
3,3,4,4,5,5-hexafluoro-1-(3,3,4,4,5,5-hexafluoro-2-methoxycyclopenten-1-yl)-2-methoxycyclopentene (PubChem CID 10386828) has the molecular formula C12H6F12O2 and a molecular weight of 410.15 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1-(3,3,4,4,5,5-hexafluoro-2-methoxycyclopenten-1-yl)-2-methoxycyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1-(3,3,4,4,5,5-hexafluoro-2-methoxycyclopenten-1-yl)-2-methoxycyclopentene |
|---|---|
| PubChem CID | 10386828 |
| Molecular Formula | C12H6F12O2 |
| Molecular Weight | 410.15 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1-(3,3,4,4,5,5-hexafluoro-2-methoxycyclopenten-1-yl)-2-methoxycyclopentene |
| SMILES | COC1=C(C2=C(OC)C(F)(F)C(F)(F)C2(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C12H6F12O2/c1-25-5-3(7(13,14)11(21,22)9(5,17)18)4-6(26-2)10(19,20)12(23,24)8(4,15)16/h1-2H3 |
| InChIKey | GQXJEHSBIUNCNE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.15 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|