C11H3F13O — CID 10000896
1,3,3,4,4,5,5-heptafluoro-2-(3,3,4,4,5,5-hexafluoro-2-methoxycyclopenten-1-yl)cyclopentene (PubChem CID 10000896) has the molecular formula C11H3F13O and a molecular weight of 398.12 g/mol. Its IUPAC name is 1,3,3,4,4,5,5-heptafluoro-2-(3,3,4,4,5,5-hexafluoro-2-methoxycyclopenten-1-yl)cyclopentene.
| Compound Name | 1,3,3,4,4,5,5-heptafluoro-2-(3,3,4,4,5,5-hexafluoro-2-methoxycyclopenten-1-yl)cyclopentene |
|---|---|
| PubChem CID | 10000896 |
| Molecular Formula | C11H3F13O |
| Molecular Weight | 398.12 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | 1,3,3,4,4,5,5-heptafluoro-2-(3,3,4,4,5,5-hexafluoro-2-methoxycyclopenten-1-yl)cyclopentene |
| SMILES | COC1=C(C2=C(F)C(F)(F)C(F)(F)C2(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H3F13O/c1-25-5-3(7(15,16)11(23,24)9(5,19)20)2-4(12)8(17,18)10(21,22)6(2,13)14/h1H3 |
| InChIKey | GMNRGCHYXTTYJD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.12 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|