C8H3F11O — CID 15579289
3,3,4,4,5,5,6,6-octafluoro-1-methoxy-2-(trifluoromethyl)cyclohexene (PubChem CID 15579289) has the molecular formula C8H3F11O and a molecular weight of 324.09 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6-octafluoro-1-methoxy-2-(trifluoromethyl)cyclohexene.
| Compound Name | 3,3,4,4,5,5,6,6-octafluoro-1-methoxy-2-(trifluoromethyl)cyclohexene |
|---|---|
| PubChem CID | 15579289 |
| Molecular Formula | C8H3F11O |
| Molecular Weight | 324.09 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 3,3,4,4,5,5,6,6-octafluoro-1-methoxy-2-(trifluoromethyl)cyclohexene |
| SMILES | COC1=C(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8H3F11O/c1-20-3-2(6(13,14)15)4(9,10)7(16,17)8(18,19)5(3,11)12/h1H3 |
| InChIKey | BWQQKPLGJCZGLT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.09 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|