C12F18 — CID 12661372
3,3,4,4,5,5-hexafluoro-1-[3,3,4,4,5,5-hexafluoro-2-(trifluoromethyl)cyclopenten-1-yl]-2-(trifluoromethyl)cyclopentene (PubChem CID 12661372) has the molecular formula C12F18 and a molecular weight of 486.10 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1-[3,3,4,4,5,5-hexafluoro-2-(trifluoromethyl)cyclopenten-1-yl]-2-(trifluoromethyl)cyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1-[3,3,4,4,5,5-hexafluoro-2-(trifluoromethyl)cyclopenten-1-yl]-2-(trifluoromethyl)cyclopentene |
|---|---|
| PubChem CID | 12661372 |
| Molecular Formula | C12F18 |
| Molecular Weight | 486.10 g/mol |
| Exact Mass | 485.97 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1-[3,3,4,4,5,5-hexafluoro-2-(trifluoromethyl)cyclopenten-1-yl]-2-(trifluoromethyl)cyclopentene |
| SMILES | FC(F)(F)C1=C(C2=C(C(F)(F)F)C(F)(F)C(F)(F)C2(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C12F18/c13-5(14)1(3(9(21,22)23)7(17,18)11(5,27)28)2-4(10(24,25)26)8(19,20)12(29,30)6(2,15)16 |
| InChIKey | VIGKZQPQZZROCL-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.10 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|