C20H23NO3 — CID 10019220
(3aR,4S,7aR)-1-benzyl-4-phenylmethoxy-3,3a,4,5,7,7a-hexahydropyrano[3,4-c][1,2]oxazole (PubChem CID 10019220) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is (3aR,4S,7aR)-1-benzyl-4-phenylmethoxy-3,3a,4,5,7,7a-hexahydropyrano[3,4-c][1,2]oxazole.
| Compound Name | (3aR,4S,7aR)-1-benzyl-4-phenylmethoxy-3,3a,4,5,7,7a-hexahydropyrano[3,4-c][1,2]oxazole |
|---|---|
| PubChem CID | 10019220 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | (3aR,4S,7aR)-1-benzyl-4-phenylmethoxy-3,3a,4,5,7,7a-hexahydropyrano[3,4-c][1,2]oxazole |
| SMILES | c1ccc(CO[C@@H]2COC[C@H]3[C@@H]2CON3Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H23NO3/c1-3-7-16(8-4-1)11-21-19-14-22-15-20(18(19)13-24-21)23-12-17-9-5-2-6-10-17/h1-10,18-20H,11-15H2/t18-,19-,20+/m0/s1 |
| InChIKey | LCROIKOQBLKJHA-SLFFLAALSA-N |
| XLogP | 3.03 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |