C19H17FN4O — CID 10019891
(E)-3-(2-fluorophenyl)-N-[(1S)-1-[3-(1,2,4-triazol-1-yl)phenyl]ethyl]prop-2-enamide (PubChem CID 10019891) has the molecular formula C19H17FN4O and a molecular weight of 336.37 g/mol. Its IUPAC name is (E)-3-(2-fluorophenyl)-N-[(1S)-1-[3-(1,2,4-triazol-1-yl)phenyl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2-fluorophenyl)-N-[(1S)-1-[3-(1,2,4-triazol-1-yl)phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 10019891 |
| Molecular Formula | C19H17FN4O |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (E)-3-(2-fluorophenyl)-N-[(1S)-1-[3-(1,2,4-triazol-1-yl)phenyl]ethyl]prop-2-enamide |
| SMILES | C[C@H](NC(=O)/C=C/c1ccccc1F)c1cccc(-n2cncn2)c1 |
| InChI | InChI=1S/C19H17FN4O/c1-14(16-6-4-7-17(11-16)24-13-21-12-22-24)23-19(25)10-9-15-5-2-3-8-18(15)20/h2-14H,1H3,(H,23,25)/b10-9+/t14-/m0/s1 |
| InChIKey | KPXTWHYAWJDFLL-HBWSCVEGSA-N |
| XLogP | 3.30 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|