C16H20N2O4S — CID 10019903
ethyl (2E)-2-[3-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-2-imino-1,3-thiazolidin-4-ylidene]acetate (PubChem CID 10019903) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is ethyl (2E)-2-[3-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-2-imino-1,3-thiazolidin-4-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[3-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-2-imino-1,3-thiazolidin-4-ylidene]acetate |
|---|---|
| PubChem CID | 10019903 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | ethyl (2E)-2-[3-[2-hydroxy-2-(4-methoxyphenyl)ethyl]-2-imino-1,3-thiazolidin-4-ylidene]acetate |
| SMILES | [H]/N=C1\SC/C(=C\C(=O)OCC)N1CC(O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H20N2O4S/c1-3-22-15(20)8-12-10-23-16(17)18(12)9-14(19)11-4-6-13(21-2)7-5-11/h4-8,14,17,19H,3,9-10H2,1-2H3/b12-8+,17-16- |
| InChIKey | IPDPOLNQFWHSTQ-REPNUXLXSA-N |
| XLogP | 2.16 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|