C19H20N3O4- — CID 10021089
[1-methoxy-3-[4-methoxy-N-(2-phenylethyl)anilino]-1,3-dioxopropan-2-yl]iminoazanide (PubChem CID 10021089) has the molecular formula C19H20N3O4- and a molecular weight of 354.39 g/mol. Its IUPAC name is [1-methoxy-3-[4-methoxy-N-(2-phenylethyl)anilino]-1,3-dioxopropan-2-yl]iminoazanide.
| Compound Name | [1-methoxy-3-[4-methoxy-N-(2-phenylethyl)anilino]-1,3-dioxopropan-2-yl]iminoazanide |
|---|---|
| PubChem CID | 10021089 |
| Molecular Formula | C19H20N3O4- |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | [1-methoxy-3-[4-methoxy-N-(2-phenylethyl)anilino]-1,3-dioxopropan-2-yl]iminoazanide |
| SMILES | COC(=O)C(N=[N-])C(=O)N(CCc1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H20N3O4/c1-25-16-10-8-15(9-11-16)22(13-12-14-6-4-3-5-7-14)18(23)17(21-20)19(24)26-2/h3-11,17H,12-13H2,1-2H3/q-1 |
| InChIKey | HJHRPFRAMCWQRZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 90.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|