C22H24N2O3S — CID 10023661
(2S)-N-[(3S)-2-oxothiolan-3-yl]-3-phenyl-2-(3-phenylpropanoylamino)propanamide (PubChem CID 10023661) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is (2S)-N-[(3S)-2-oxothiolan-3-yl]-3-phenyl-2-(3-phenylpropanoylamino)propanamide.
| Compound Name | (2S)-N-[(3S)-2-oxothiolan-3-yl]-3-phenyl-2-(3-phenylpropanoylamino)propanamide |
|---|---|
| PubChem CID | 10023661 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (2S)-N-[(3S)-2-oxothiolan-3-yl]-3-phenyl-2-(3-phenylpropanoylamino)propanamide |
| SMILES | O=C(CCc1ccccc1)N[C@@H](Cc1ccccc1)C(=O)N[C@H]1CCSC1=O |
| InChI | InChI=1S/C22H24N2O3S/c25-20(12-11-16-7-3-1-4-8-16)23-19(15-17-9-5-2-6-10-17)21(26)24-18-13-14-28-22(18)27/h1-10,18-19H,11-15H2,(H,23,25)(H,24,26)/t18-,19-/m0/s1 |
| InChIKey | FGRHKSQXRPXQEP-OALUTQOASA-N |
| XLogP | 2.49 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|