C23H25NO5S — CID 10025551
2-[4-[2-[(3-propylazulen-1-yl)sulfonylamino]ethyl]phenoxy]acetic acid (PubChem CID 10025551) has the molecular formula C23H25NO5S and a molecular weight of 427.52 g/mol. Its IUPAC name is 2-[4-[2-[(3-propylazulen-1-yl)sulfonylamino]ethyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[2-[(3-propylazulen-1-yl)sulfonylamino]ethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 10025551 |
| Molecular Formula | C23H25NO5S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 2-[4-[2-[(3-propylazulen-1-yl)sulfonylamino]ethyl]phenoxy]acetic acid |
| SMILES | CCCc1cc(S(=O)(=O)NCCc2ccc(OCC(=O)O)cc2)c2cccccc1-2 |
| InChI | InChI=1S/C23H25NO5S/c1-2-6-18-15-22(21-8-5-3-4-7-20(18)21)30(27,28)24-14-13-17-9-11-19(12-10-17)29-16-23(25)26/h3-5,7-12,15,24H,2,6,13-14,16H2,1H3,(H,25,26) |
| InChIKey | IKZMBXISBNQTRV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |