C23H25NO6S — CID 10343365
2-[4-[2-[(3-ethyl-4-methoxyazulen-1-yl)sulfonylamino]ethyl]phenoxy]acetic acid (PubChem CID 10343365) has the molecular formula C23H25NO6S and a molecular weight of 443.52 g/mol. Its IUPAC name is 2-[4-[2-[(3-ethyl-4-methoxyazulen-1-yl)sulfonylamino]ethyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[2-[(3-ethyl-4-methoxyazulen-1-yl)sulfonylamino]ethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 10343365 |
| Molecular Formula | C23H25NO6S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 2-[4-[2-[(3-ethyl-4-methoxyazulen-1-yl)sulfonylamino]ethyl]phenoxy]acetic acid |
| SMILES | CCc1cc(S(=O)(=O)NCCc2ccc(OCC(=O)O)cc2)c2ccccc(OC)c1-2 |
| InChI | InChI=1S/C23H25NO6S/c1-3-17-14-21(19-6-4-5-7-20(29-2)23(17)19)31(27,28)24-13-12-16-8-10-18(11-9-16)30-15-22(25)26/h4-11,14,24H,3,12-13,15H2,1-2H3,(H,25,26) |
| InChIKey | KJGDTIUIPAKSCA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |