C24H27NO5S — CID 10411045
2-[4-[2-[(3-butylazulen-1-yl)sulfonylamino]ethyl]phenoxy]acetic acid (PubChem CID 10411045) has the molecular formula C24H27NO5S and a molecular weight of 441.55 g/mol. Its IUPAC name is 2-[4-[2-[(3-butylazulen-1-yl)sulfonylamino]ethyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[2-[(3-butylazulen-1-yl)sulfonylamino]ethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 10411045 |
| Molecular Formula | C24H27NO5S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 2-[4-[2-[(3-butylazulen-1-yl)sulfonylamino]ethyl]phenoxy]acetic acid |
| SMILES | CCCCc1cc(S(=O)(=O)NCCc2ccc(OCC(=O)O)cc2)c2cccccc1-2 |
| InChI | InChI=1S/C24H27NO5S/c1-2-3-7-19-16-23(22-9-6-4-5-8-21(19)22)31(28,29)25-15-14-18-10-12-20(13-11-18)30-17-24(26)27/h4-6,8-13,16,25H,2-3,7,14-15,17H2,1H3,(H,26,27) |
| InChIKey | MQXKSQJZLVZKMY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |