C20H39NO9 — CID 10026088
(2S,3S,4R,5S,6S)-2-[(2R,3R,4S,5R,6R)-6-(aminomethyl)-4,5-dihydroxy-2-octoxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol (PubChem CID 10026088) has the molecular formula C20H39NO9 and a molecular weight of 437.53 g/mol. Its IUPAC name is (2S,3S,4R,5S,6S)-2-[(2R,3R,4S,5R,6R)-6-(aminomethyl)-4,5-dihydroxy-2-octoxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5S,6S)-2-[(2R,3R,4S,5R,6R)-6-(aminomethyl)-4,5-dihydroxy-2-octoxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 10026088 |
| Molecular Formula | C20H39NO9 |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | (2S,3S,4R,5S,6S)-2-[(2R,3R,4S,5R,6R)-6-(aminomethyl)-4,5-dihydroxy-2-octoxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
| SMILES | CCCCCCCCO[C@@H]1O[C@H](CN)[C@H](O)[C@H](O)[C@H]1O[C@@H]1O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H39NO9/c1-3-4-5-6-7-8-9-27-20-18(16(25)14(23)12(10-21)29-20)30-19-17(26)15(24)13(22)11(2)28-19/h11-20,22-26H,3-10,21H2,1-2H3/t11-,12+,13+,14-,15+,16-,17-,18+,19-,20+/m0/s1 |
| InChIKey | SLRYWALEWAEJOS-ARNYJBIMSA-N |
| XLogP | -1.02 |
| TPSA | 164.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|